Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium borohydride, 98%, granules, ca 3 mm
CAS: 16940-66-2 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003518 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: Sodium tetrahydroborate,SBH IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium tetrahydroborate,SBH |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
Zeolite beta, ammonium
CAS: 1318-02-1 Molecular Formula: Al2O5Si Molecular Weight (g/mol): 162.043 MDL Number: MFCD00132601 InChI Key: HNPSIPDUKPIQMN-UHFFFAOYSA-N Synonym: kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural PubChem CID: 9942228 IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane SMILES: O=[Al]O[Al]=O.O=[Si]=O
| PubChem CID | 9942228 |
|---|---|
| CAS | 1318-02-1 |
| Molecular Weight (g/mol) | 162.043 |
| MDL Number | MFCD00132601 |
| SMILES | O=[Al]O[Al]=O.O=[Si]=O |
| Synonym | kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural |
| IUPAC Name | dioxosilane;oxo(oxoalumanyloxy)alumane |
| InChI Key | HNPSIPDUKPIQMN-UHFFFAOYSA-N |
| Molecular Formula | Al2O5Si |
Antimony(III) sulfide, 98% (metals basis)
CAS: 1345-04-6 Molecular Formula: S3Sb2 Molecular Weight (g/mol): 339.70 MDL Number: MFCD00011217 InChI Key: NVWBARWTDVQPJD-UHFFFAOYSA-N Synonym: Antimony trisulfide IUPAC Name: diantimony(3+) trisulfanediide SMILES: [S--].[S--].[S--].[Sb+3].[Sb+3]
| CAS | 1345-04-6 |
|---|---|
| Molecular Weight (g/mol) | 339.70 |
| MDL Number | MFCD00011217 |
| SMILES | [S--].[S--].[S--].[Sb+3].[Sb+3] |
| Synonym | Antimony trisulfide |
| IUPAC Name | diantimony(3+) trisulfanediide |
| InChI Key | NVWBARWTDVQPJD-UHFFFAOYSA-N |
| Molecular Formula | S3Sb2 |
1H,1H,2H,2H-Perfluorodecyltriethoxysilane, 97%, Thermo Scientific™
CAS: 101947-16-4 Molecular Formula: C16H19F17O3Si Molecular Weight (g/mol): 610.38 MDL Number: MFCD00042334 InChI Key: MLXDKRSDUJLNAB-UHFFFAOYSA-N Synonym: 1h,1h,2h,2h-perfluorodecyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,heptadecafluoro-1,1,2,2-tetrahydrodecyl triethoxysilane,perfluorooctylethyl triethoxysilane,r-3-hydroxy-1-benyzl-pyrrolidine,triethoxy-1h,1h,2h,2h-perfluorodecylsilane,triethoxy-1h,1h,2h,2h-heptadecafluorodecylsilane,1h,1h,2h,2h-perfluorodec-1-yl tris ethoxy silan,1h,1h,2h,2h-perfluorodecyltriethoxysilane 1g PubChem CID: 145374 IUPAC Name: triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane SMILES: CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC
| PubChem CID | 145374 |
|---|---|
| CAS | 101947-16-4 |
| Molecular Weight (g/mol) | 610.38 |
| MDL Number | MFCD00042334 |
| SMILES | CCO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OCC)OCC |
| Synonym | 1h,1h,2h,2h-perfluorodecyltriethoxysilane,triethoxy 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl silane,heptadecafluoro-1,1,2,2-tetrahydrodecyl triethoxysilane,perfluorooctylethyl triethoxysilane,r-3-hydroxy-1-benyzl-pyrrolidine,triethoxy-1h,1h,2h,2h-perfluorodecylsilane,triethoxy-1h,1h,2h,2h-heptadecafluorodecylsilane,1h,1h,2h,2h-perfluorodec-1-yl tris ethoxy silan,1h,1h,2h,2h-perfluorodecyltriethoxysilane 1g |
| IUPAC Name | triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane |
| InChI Key | MLXDKRSDUJLNAB-UHFFFAOYSA-N |
| Molecular Formula | C16H19F17O3Si |
3,5-Bis(trifluoromethyl)phenyldimethylsilane, 95%
CAS: 33558-36-0 Molecular Formula: C10H9F6Si Molecular Weight (g/mol): 271.257 MDL Number: MFCD02093948 InChI Key: HJQABLGRCWBCDT-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane PubChem CID: 11219490 IUPAC Name: [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon SMILES: C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F
| PubChem CID | 11219490 |
|---|---|
| CAS | 33558-36-0 |
| Molecular Weight (g/mol) | 271.257 |
| MDL Number | MFCD02093948 |
| SMILES | C[Si](C)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenyl dimethylsilane,3,5-bis trifluoromethyl phenyl-dimethyl-silicon,3,5-bis-trifluoromethyl phenyldimethylsilane,3,5-bis trifluoromethyl phenyl-dimethylsilicon,3,5-bis trifluoromethyl phenyldimethylsilane |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-dimethylsilicon |
| InChI Key | HJQABLGRCWBCDT-UHFFFAOYSA-N |
| Molecular Formula | C10H9F6Si |
Silicon powder, crystalline, -100+200 mesh, 99.99% (metals basis)
CAS: 7440-21-3 Molecular Formula: Si Molecular Weight (g/mol): 28.09 MDL Number: MFCD00085311 InChI Key: XUIMIQQOPSSXEZ-UHFFFAOYSA-N Synonym: metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 PubChem CID: 5461123 ChEBI: CHEBI:27573 IUPAC Name: silicon SMILES: [Si]
| PubChem CID | 5461123 |
|---|---|
| CAS | 7440-21-3 |
| Molecular Weight (g/mol) | 28.09 |
| ChEBI | CHEBI:27573 |
| MDL Number | MFCD00085311 |
| SMILES | [Si] |
| Synonym | metal,silicone,defoamer s-10,flots 100sco,powder,dust,unii-z4152n8iui,polyeristalline powder,ccris 6599,ccris 6831 |
| IUPAC Name | silicon |
| InChI Key | XUIMIQQOPSSXEZ-UHFFFAOYSA-N |
| Molecular Formula | Si |
Selenium(IV) oxide, Puratronic™, 99.999% (metals basis)
CAS: 7446-08-4 Molecular Formula: O2Se Molecular Weight (g/mol): 110.97 MDL Number: MFCD00003562 InChI Key: JPJALAQPGMAKDF-UHFFFAOYSA-N Synonym: selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 PubChem CID: 24007 IUPAC Name: selenium dioxide SMILES: O=[Se]=O
| PubChem CID | 24007 |
|---|---|
| CAS | 7446-08-4 |
| Molecular Weight (g/mol) | 110.97 |
| MDL Number | MFCD00003562 |
| SMILES | O=[Se]=O |
| Synonym | selenium oxide,selenium iv oxide,oxoselane oxide,selenious anhydride,selenium oxide seo2,seleniumdioxide,dimer,selenous acid anhydride,selenium iv dioxide 1:2,selenium oxide se2o4 |
| IUPAC Name | selenium dioxide |
| InChI Key | JPJALAQPGMAKDF-UHFFFAOYSA-N |
| Molecular Formula | O2Se |
3-(Phenylamino)propyltrimethoxysilane, 96%
CAS: 3068-76-6 Molecular Formula: C12H21NO3Si Molecular Weight (g/mol): 255.389 MDL Number: MFCD00053673 InChI Key: KBJFYLLAMSZSOG-UHFFFAOYSA-N Synonym: n-3-trimethoxysilyl propyl aniline,trimethoxy 3-phenylamino propyl silane,n-phenylaminopropyltrimethoxysilane,unii-7au1h1fv6a,benzenamine, n-3-trimethoxysilyl propyl,n-phenyl-3-aminopropyltrimethoxysilane,7au1h1fv6a,n-3-trimethoxysilylpropyl aniline,3-phenylamino propyltrimethoxysilane PubChem CID: 76476 IUPAC Name: N-(3-trimethoxysilylpropyl)aniline SMILES: CO[Si](CCCNC1=CC=CC=C1)(OC)OC
| PubChem CID | 76476 |
|---|---|
| CAS | 3068-76-6 |
| Molecular Weight (g/mol) | 255.389 |
| MDL Number | MFCD00053673 |
| SMILES | CO[Si](CCCNC1=CC=CC=C1)(OC)OC |
| Synonym | n-3-trimethoxysilyl propyl aniline,trimethoxy 3-phenylamino propyl silane,n-phenylaminopropyltrimethoxysilane,unii-7au1h1fv6a,benzenamine, n-3-trimethoxysilyl propyl,n-phenyl-3-aminopropyltrimethoxysilane,7au1h1fv6a,n-3-trimethoxysilylpropyl aniline,3-phenylamino propyltrimethoxysilane |
| IUPAC Name | N-(3-trimethoxysilylpropyl)aniline |
| InChI Key | KBJFYLLAMSZSOG-UHFFFAOYSA-N |
| Molecular Formula | C12H21NO3Si |
Chlorodimethylphenylsilane, 97+%
CAS: 768-33-2 Molecular Formula: C8H11ClSi Molecular Weight (g/mol): 170.71 MDL Number: MFCD00000499 InChI Key: KWYZNESIGBQHJK-UHFFFAOYSA-N Synonym: chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 PubChem CID: 13029 IUPAC Name: chloro-dimethyl-phenylsilane SMILES: C[Si](C)(Cl)C1=CC=CC=C1
| PubChem CID | 13029 |
|---|---|
| CAS | 768-33-2 |
| Molecular Weight (g/mol) | 170.71 |
| MDL Number | MFCD00000499 |
| SMILES | C[Si](C)(Cl)C1=CC=CC=C1 |
| Synonym | chlorodimethylphenylsilane,chlorodimethyl phenyl silane,phenyldimethylchlorosilane,silane, chlorodimethylphenyl,dimethylphenylchlorosilane,chloro dimethyl phenylsilane,phenyl dimethylchlorosilane,chloro-dimethyl-phenyl-silane,benzene, chlorodimethylsilyl,pubchem10814 |
| IUPAC Name | chloro-dimethyl-phenylsilane |
| InChI Key | KWYZNESIGBQHJK-UHFFFAOYSA-N |
| Molecular Formula | C8H11ClSi |
| Linear Formula | BCl3 |
|---|---|
| CAS | 10294-34-5 |
| MDL Number | MFCD00011313 |
| Grade | GC Derivatization |
| Density | 0.875-0.895 g/mL (at 20°C) |
| Formula Weight | 117.17 |
| Product Line | LiChropur |
1,4-Bis[(trimethylsilyl)ethynyl]benzene, 98%
CAS: 17938-13-5 Molecular Formula: C16H22Si2 Molecular Weight (g/mol): 270.522 MDL Number: MFCD00135433 InChI Key: CMTMWEXUJQSPCA-UHFFFAOYSA-N Synonym: 1,4-bis trimethylsilyl ethynyl benzene,1,4-bis trimethylsilylethynyl benzene,1,4-bis 2-trimethylsilyl ethynyl benzene,trimethyl-2-4-2-trimethylsilylethynyl phenyl ethynyl silane,trimethyl 2-4-2-trimethylsilyl ethynyl phenyl ethynyl silane,acmc-20ap2w,trimethyl 4-trimethylsilyl ethynyl phenyl ethynyl silane,benzene,1,4-bis 2-trimethylsilyl ethynyl PubChem CID: 522492 IUPAC Name: trimethyl-[2-[4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane SMILES: C[Si](C)(C)C#CC1=CC=C(C=C1)C#C[Si](C)(C)C
| PubChem CID | 522492 |
|---|---|
| CAS | 17938-13-5 |
| Molecular Weight (g/mol) | 270.522 |
| MDL Number | MFCD00135433 |
| SMILES | C[Si](C)(C)C#CC1=CC=C(C=C1)C#C[Si](C)(C)C |
| Synonym | 1,4-bis trimethylsilyl ethynyl benzene,1,4-bis trimethylsilylethynyl benzene,1,4-bis 2-trimethylsilyl ethynyl benzene,trimethyl-2-4-2-trimethylsilylethynyl phenyl ethynyl silane,trimethyl 2-4-2-trimethylsilyl ethynyl phenyl ethynyl silane,acmc-20ap2w,trimethyl 4-trimethylsilyl ethynyl phenyl ethynyl silane,benzene,1,4-bis 2-trimethylsilyl ethynyl |
| IUPAC Name | trimethyl-[2-[4-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
| InChI Key | CMTMWEXUJQSPCA-UHFFFAOYSA-N |
| Molecular Formula | C16H22Si2 |
Arsenic(III) iodide, 99.999% (metals basis)
CAS: 7784-45-4 Molecular Formula: AsI3 Molecular Weight (g/mol): 455.635 MDL Number: MFCD00014170 InChI Key: IKIBSPLDJGAHPX-UHFFFAOYSA-N Synonym: arsenous triiodide,arsenic iii iodide,arsenic iodide,arsenic triiodide,triiodoarsine,arsenous iodide,hsdb 420,arsen iii-jodid PubChem CID: 24575 IUPAC Name: triiodoarsane SMILES: [As](I)(I)I
| PubChem CID | 24575 |
|---|---|
| CAS | 7784-45-4 |
| Molecular Weight (g/mol) | 455.635 |
| MDL Number | MFCD00014170 |
| SMILES | [As](I)(I)I |
| Synonym | arsenous triiodide,arsenic iii iodide,arsenic iodide,arsenic triiodide,triiodoarsine,arsenous iodide,hsdb 420,arsen iii-jodid |
| IUPAC Name | triiodoarsane |
| InChI Key | IKIBSPLDJGAHPX-UHFFFAOYSA-N |
| Molecular Formula | AsI3 |
Tellurium(IV) oxide, Puratronic, 99.999% (metals basis)
CAS: 7446-07-3 Molecular Formula: O2Te Molecular Weight (g/mol): 159.60 MDL Number: MFCD00011263 InChI Key: LAJZODKXOMJMPK-UHFFFAOYSA-N Synonym: tellurium iv oxide,tellurium oxide teo2,tellurite teo2,teo2,unii-397e9rke83,oxotellane oxide,telluride oxide,6-chlorobutyric acid,acmc-1bglq PubChem CID: 62638 SMILES: O=[Te]=O
| PubChem CID | 62638 |
|---|---|
| CAS | 7446-07-3 |
| Molecular Weight (g/mol) | 159.60 |
| MDL Number | MFCD00011263 |
| SMILES | O=[Te]=O |
| Synonym | tellurium iv oxide,tellurium oxide teo2,tellurite teo2,teo2,unii-397e9rke83,oxotellane oxide,telluride oxide,6-chlorobutyric acid,acmc-1bglq |
| InChI Key | LAJZODKXOMJMPK-UHFFFAOYSA-N |
| Molecular Formula | O2Te |
Magnesium Foil, 0.15-0.30mm Thickness, 3mm Wide, MilliporeSigma™
CAS: 7439-95-4 Molecular Formula: Mg Molecular Weight (g/mol): 24.30 MDL Number: MFCD00085308 InChI Key: JLVVSXFLKOJNIY-UHFFFAOYSA-N Synonym: magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs PubChem CID: 5462224 ChEBI: CHEBI:25107 IUPAC Name: magnesium SMILES: [Mg]
| PubChem CID | 5462224 |
|---|---|
| CAS | 7439-95-4 |
| Molecular Weight (g/mol) | 24.30 |
| ChEBI | CHEBI:25107 |
| MDL Number | MFCD00085308 |
| SMILES | [Mg] |
| Synonym | magnesio,sheet,powdered,magnesio italian,turnings,rieke's active,ribbon,unii-i38zp9992a,hsdb 654,nitrate, acs |
| IUPAC Name | magnesium |
| InChI Key | JLVVSXFLKOJNIY-UHFFFAOYSA-N |
| Molecular Formula | Mg |
2-Mesitylmagnesium bromide, 1M solution in THF, AcroSeal™
CAS: 2633-66-1 Molecular Formula: C9H11BrMg Molecular Weight (g/mol): 223.40 MDL Number: MFCD00009663 InChI Key: VZMGGVXGYWKQPB-UHFFFAOYSA-M Synonym: 2-mesitylmagnesium bromide,mesitylmagnesium bromide,2,4,6-trimethylphenylmagnesium bromide,2-mesitylmagnesium bromide solution,mesmgbr,yxvsitsudrgill-uhfffaoysa-m,magnesium,bromo 2,4,6-trimethylphenyl,2-mesitylmagnesium bromide solution, 1.0 m in thf,2,4,6-trimethylphenylmagnesium bromide, 1m in 2-methf,2-mesitylmagnesium bromide solution, 1.0 m in diethyl ether,grignard reagent PubChem CID: 5098599 IUPAC Name: bromo(3,4,5-trimethylphenyl)magnesium SMILES: CC1=CC([Mg]Br)=CC(C)=C1C
| PubChem CID | 5098599 |
|---|---|
| CAS | 2633-66-1 |
| Molecular Weight (g/mol) | 223.40 |
| MDL Number | MFCD00009663 |
| SMILES | CC1=CC([Mg]Br)=CC(C)=C1C |
| Synonym | 2-mesitylmagnesium bromide,mesitylmagnesium bromide,2,4,6-trimethylphenylmagnesium bromide,2-mesitylmagnesium bromide solution,mesmgbr,yxvsitsudrgill-uhfffaoysa-m,magnesium,bromo 2,4,6-trimethylphenyl,2-mesitylmagnesium bromide solution, 1.0 m in thf,2,4,6-trimethylphenylmagnesium bromide, 1m in 2-methf,2-mesitylmagnesium bromide solution, 1.0 m in diethyl ether,grignard reagent |
| IUPAC Name | bromo(3,4,5-trimethylphenyl)magnesium |
| InChI Key | VZMGGVXGYWKQPB-UHFFFAOYSA-M |
| Molecular Formula | C9H11BrMg |